C30H31N5O3 — CID 171829305
3-[3-oxo-6-[[4-[phenyl(pyridin-4-yl)methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829305) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is 3-[3-oxo-6-[[4-[phenyl(pyridin-4-yl)methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[[4-[phenyl(pyridin-4-yl)methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829305 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 3-[3-oxo-6-[[4-[phenyl(pyridin-4-yl)methyl]piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCN(C(c5ccccc5)c5ccncc5)CC4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H31N5O3/c36-27-9-8-26(29(37)32-27)35-20-24-18-21(6-7-25(24)30(35)38)19-33-14-16-34(17-15-33)28(22-4-2-1-3-5-22)23-10-12-31-13-11-23/h1-7,10-13,18,26,28H,8-9,14-17,19-20H2,(H,32,36,37) |
| InChIKey | QWLKNUXIDQWXOG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|