C29H29FN6O3 — CID 171829038
3-[6-[[4-(dipyridin-4-ylmethyl)piperazin-1-yl]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171829038) has the molecular formula C29H29FN6O3 and a molecular weight of 528.59 g/mol. Its IUPAC name is 3-[6-[[4-(dipyridin-4-ylmethyl)piperazin-1-yl]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[4-(dipyridin-4-ylmethyl)piperazin-1-yl]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171829038 |
| Molecular Formula | C29H29FN6O3 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 3-[6-[[4-(dipyridin-4-ylmethyl)piperazin-1-yl]methyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CN4CCN(C(c5ccncc5)c5ccncc5)CC4)cc(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H29FN6O3/c30-23-16-19(15-22-18-36(29(39)26(22)23)24-1-2-25(37)33-28(24)38)17-34-11-13-35(14-12-34)27(20-3-7-31-8-4-20)21-5-9-32-10-6-21/h3-10,15-16,24,27H,1-2,11-14,17-18H2,(H,33,37,38) |
| InChIKey | YLYKGEGZPSYFBM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|