C36H38FN5O4 — CID 177163438
3-[6-[4-(4-benzhydrylpiperazin-1-yl)piperidine-1-carbonyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 177163438) has the molecular formula C36H38FN5O4 and a molecular weight of 623.73 g/mol. Its IUPAC name is 3-[6-[4-(4-benzhydrylpiperazin-1-yl)piperidine-1-carbonyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(4-benzhydrylpiperazin-1-yl)piperidine-1-carbonyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177163438 |
| Molecular Formula | C36H38FN5O4 |
| Molecular Weight | 623.73 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 3-[6-[4-(4-benzhydrylpiperazin-1-yl)piperidine-1-carbonyl]-4-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(C(=O)N4CCC(N5CCN(C(c6ccccc6)c6ccccc6)CC5)CC4)cc(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H38FN5O4/c37-29-22-26(21-27-23-42(36(46)32(27)29)30-11-12-31(43)38-34(30)44)35(45)41-15-13-28(14-16-41)39-17-19-40(20-18-39)33(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-10,21-22,28,30,33H,11-20,23H2,(H,38,43,44) |
| InChIKey | SGPGAYMFGZTYOH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|