C24H25N3O5S — CID 155316213
2-(4-tert-butylphenyl)-N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl]-2-oxoacetamide (PubChem CID 155316213) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl]-2-oxoacetamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 155316213 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[[5-(2,6-dioxopiperidin-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl]-2-oxoacetamide |
| SMILES | CC(C)(C)c1ccc(C(=O)C(=O)NCc2cc3c(s2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-24(2,3)15-6-4-13(5-7-15)19(29)22(31)25-11-16-10-14-12-27(23(32)20(14)33-16)17-8-9-18(28)26-21(17)30/h4-7,10,17H,8-9,11-12H2,1-3H3,(H,25,31)(H,26,28,30) |
| InChIKey | WPPIXWQHHLGVEU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|