C22H26N2O4S — CID 153374638
(3S)-3-[2-[(4-tert-butylphenoxy)methyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]piperidine-2,6-dione;molecular hydrogen (PubChem CID 153374638) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is (3S)-3-[2-[(4-tert-butylphenoxy)methyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]piperidine-2,6-dione;molecular hydrogen.
| Compound Name | (3S)-3-[2-[(4-tert-butylphenoxy)methyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]piperidine-2,6-dione;molecular hydrogen |
|---|---|
| PubChem CID | 153374638 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (3S)-3-[2-[(4-tert-butylphenoxy)methyl]-6-oxo-4H-thieno[2,3-c]pyrrol-5-yl]piperidine-2,6-dione;molecular hydrogen |
| SMILES | CC(C)(C)c1ccc(OCc2cc3c(s2)C(=O)N([C@H]2CCC(=O)NC2=O)C3)cc1.[H][H] |
| InChI | InChI=1S/C22H24N2O4S.H2/c1-22(2,3)14-4-6-15(7-5-14)28-12-16-10-13-11-24(21(27)19(13)29-16)17-8-9-18(25)23-20(17)26;/h4-7,10,17H,8-9,11-12H2,1-3H3,(H,23,25,26);1H/t17-;/m0./s1 |
| InChIKey | PGFXIAUJZAYMCY-LMOVPXPDSA-N |
| XLogP | 3.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|