C14H15N3O5S — CID 134608341
[5-(2,7-dioxoazepan-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl carbamate (PubChem CID 134608341) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is [5-(2,7-dioxoazepan-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl carbamate.
| Compound Name | [5-(2,7-dioxoazepan-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl carbamate |
|---|---|
| PubChem CID | 134608341 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | [5-(2,7-dioxoazepan-3-yl)-6-oxo-4H-thieno[2,3-c]pyrrol-2-yl]methyl carbamate |
| SMILES | NC(=O)OCc1cc2c(s1)C(=O)N(C1CCCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H15N3O5S/c15-14(21)22-6-8-4-7-5-17(13(20)11(7)23-8)9-2-1-3-10(18)16-12(9)19/h4,9H,1-3,5-6H2,(H2,15,21)(H,16,18,19) |
| InChIKey | VYRSNTPGPOWFBS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|