C45H48BN5O6 — CID 166021137
[4-[(Z)-1-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidine-1-carbonyl]piperazin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid (PubChem CID 166021137) has the molecular formula C45H48BN5O6 and a molecular weight of 765.72 g/mol. Its IUPAC name is [4-[(Z)-1-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidine-1-carbonyl]piperazin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid.
| Compound Name | [4-[(Z)-1-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidine-1-carbonyl]piperazin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 166021137 |
| Molecular Formula | C45H48BN5O6 |
| Molecular Weight | 765.72 g/mol |
| Exact Mass | 765.37 |
| IUPAC Name | [4-[(Z)-1-[4-[4-[4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]piperidine-1-carbonyl]piperazin-1-yl]phenyl]-2-phenylbut-1-enyl]phenyl]boronic acid |
| SMILES | CC/C(=C(\c1ccc(B(O)O)cc1)c1ccc(N2CCN(C(=O)N3CCC(c4ccc5c(c4)CN(C4CCC(=O)NC4=O)C5=O)CC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C45H48BN5O6/c1-2-38(31-6-4-3-5-7-31)42(32-8-13-36(14-9-32)46(56)57)33-10-15-37(16-11-33)48-24-26-50(27-25-48)45(55)49-22-20-30(21-23-49)34-12-17-39-35(28-34)29-51(44(39)54)40-18-19-41(52)47-43(40)53/h3-17,28,30,40,56-57H,2,18-27,29H2,1H3,(H,47,52,53)/b42-38- |
| InChIKey | FJDODFLDRYGVOT-CWAJCWQHSA-N |
| XLogP | 4.62 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.72 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|