C23H30N4O3Si — CID 165175926
3-[3-oxo-6-[4-(3-trimethylsilylprop-2-ynyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 165175926) has the molecular formula C23H30N4O3Si and a molecular weight of 438.60 g/mol. Its IUPAC name is 3-[3-oxo-6-[4-(3-trimethylsilylprop-2-ynyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[4-(3-trimethylsilylprop-2-ynyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 165175926 |
| Molecular Formula | C23H30N4O3Si |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 3-[3-oxo-6-[4-(3-trimethylsilylprop-2-ynyl)piperazin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C[Si](C)(C)C#CCN1CCN(c2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C23H30N4O3Si/c1-31(2,3)14-4-9-25-10-12-26(13-11-25)18-5-6-19-17(15-18)16-27(23(19)30)20-7-8-21(28)24-22(20)29/h5-6,15,20H,7-13,16H2,1-3H3,(H,24,28,29) |
| InChIKey | HDTRBGKHGXYDJI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|