C22H25F3N4O6 — CID 140831853
[7-amino-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1-oxoheptan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140831853) has the molecular formula C22H25F3N4O6 and a molecular weight of 498.46 g/mol. Its IUPAC name is [7-amino-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1-oxoheptan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [7-amino-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1-oxoheptan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140831853 |
| Molecular Formula | C22H25F3N4O6 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [7-amino-1-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]amino]-1-oxoheptan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | NCCCCCC(OC(=O)C(F)(F)F)C(=O)Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H25F3N4O6/c23-22(24,25)21(34)35-16(7-2-1-3-10-26)19(32)27-14-6-4-5-12-13(14)11-29(20(12)33)15-8-9-17(30)28-18(15)31/h4-6,15-16H,1-3,7-11,26H2,(H,27,32)(H,28,30,31) |
| InChIKey | ANTCRPXANQHMHJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|