C17H15N3O — CID 17418457
N-[(2-methylphenyl)methyl]quinoxaline-2-carboxamide (PubChem CID 17418457) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[(2-methylphenyl)methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 17418457 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[(2-methylphenyl)methyl]quinoxaline-2-carboxamide |
| SMILES | Cc1ccccc1CNC(=O)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C17H15N3O/c1-12-6-2-3-7-13(12)10-19-17(21)16-11-18-14-8-4-5-9-15(14)20-16/h2-9,11H,10H2,1H3,(H,19,21) |
| InChIKey | UWILAWWHUSTPKU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |