C26H20N6O2 — CID 112799416
N-[[3-[(quinoxaline-2-carbonylamino)methyl]phenyl]methyl]quinoxaline-2-carboxamide (PubChem CID 112799416) has the molecular formula C26H20N6O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[[3-[(quinoxaline-2-carbonylamino)methyl]phenyl]methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[[3-[(quinoxaline-2-carbonylamino)methyl]phenyl]methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 112799416 |
| Molecular Formula | C26H20N6O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N-[[3-[(quinoxaline-2-carbonylamino)methyl]phenyl]methyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCc1cccc(CNC(=O)c2cnc3ccccc3n2)c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C26H20N6O2/c33-25(23-15-27-19-8-1-3-10-21(19)31-23)29-13-17-6-5-7-18(12-17)14-30-26(34)24-16-28-20-9-2-4-11-22(20)32-24/h1-12,15-16H,13-14H2,(H,29,33)(H,30,34) |
| InChIKey | AWEFNIUYESIPTA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |