C19H14N4OS — CID 121177637
N-[(2-thiophen-3-yl-3-pyridinyl)methyl]quinoxaline-2-carboxamide (PubChem CID 121177637) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is N-[(2-thiophen-3-yl-3-pyridinyl)methyl]quinoxaline-2-carboxamide.
| Compound Name | N-[(2-thiophen-3-yl-3-pyridinyl)methyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 121177637 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[(2-thiophen-3-yl-3-pyridinyl)methyl]quinoxaline-2-carboxamide |
| SMILES | O=C(NCc1cccnc1-c1ccsc1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H14N4OS/c24-19(17-11-21-15-5-1-2-6-16(15)23-17)22-10-13-4-3-8-20-18(13)14-7-9-25-12-14/h1-9,11-12H,10H2,(H,22,24) |
| InChIKey | YEDUHHMHEBMONJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |