C20H23N5O6S — CID 166425498
5-[3-[[2-cyanoethyl(methyl)sulfamoyl]amino]propyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole (PubChem CID 166425498) has the molecular formula C20H23N5O6S and a molecular weight of 461.50 g/mol. Its IUPAC name is 5-[3-[[2-cyanoethyl(methyl)sulfamoyl]amino]propyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole.
| Compound Name | 5-[3-[[2-cyanoethyl(methyl)sulfamoyl]amino]propyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole |
|---|---|
| PubChem CID | 166425498 |
| Molecular Formula | C20H23N5O6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 5-[3-[[2-cyanoethyl(methyl)sulfamoyl]amino]propyl]-2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindole |
| SMILES | CN(CCC#N)S(=O)(=O)NCCCc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C20H23N5O6S/c1-24(11-3-9-21)32(30,31)22-10-2-4-13-5-6-14-15(12-13)20(29)25(19(14)28)16-7-8-17(26)23-18(16)27/h5-6,12,16,22H,2-4,7-8,10-11H2,1H3,(H,23,26,27) |
| InChIKey | PDQKKYDWIAMVKV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 156.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|