C21H23N3O9S — CID 153351586
4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylethoxy]ethylamino]-4-oxobutanoic acid (PubChem CID 153351586) has the molecular formula C21H23N3O9S and a molecular weight of 493.49 g/mol. Its IUPAC name is 4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylethoxy]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylethoxy]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 153351586 |
| Molecular Formula | C21H23N3O9S |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 4-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]sulfinylethoxy]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCOCCS(=O)c1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H23N3O9S/c25-15(6-7-17(27)28)22-8-9-33-10-11-34(32)14-3-1-2-12-18(14)21(31)24(20(12)30)13-4-5-16(26)23-19(13)29/h1-3,13H,4-11H2,(H,22,25)(H,27,28)(H,23,26,29) |
| InChIKey | LMODBFXKWAMDIM-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|