C24H29N7O4 — CID 177052211
4-[9-(2-azidoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 177052211) has the molecular formula C24H29N7O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 4-[9-(2-azidoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[9-(2-azidoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 177052211 |
| Molecular Formula | C24H29N7O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 4-[9-(2-azidoethyl)-3,9-diazaspiro[5.5]undecan-3-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCCN1CCC2(CC1)CCN(c1cccc3c1C(=O)N(C1CCC(=O)NC1=O)C3=O)CC2 |
| InChI | InChI=1S/C24H29N7O4/c25-28-26-10-15-29-11-6-24(7-12-29)8-13-30(14-9-24)17-3-1-2-16-20(17)23(35)31(22(16)34)18-4-5-19(32)27-21(18)33/h1-3,18H,4-15H2,(H,27,32,33) |
| InChIKey | SRWVSUDCBLFSRC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 138.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|