C27H26ClN3O6 — CID 166428822
N-[[1-(3-chlorophenyl)cyclopentyl]methyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide (PubChem CID 166428822) has the molecular formula C27H26ClN3O6 and a molecular weight of 523.97 g/mol. Its IUPAC name is N-[[1-(3-chlorophenyl)cyclopentyl]methyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide.
| Compound Name | N-[[1-(3-chlorophenyl)cyclopentyl]methyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide |
|---|---|
| PubChem CID | 166428822 |
| Molecular Formula | C27H26ClN3O6 |
| Molecular Weight | 523.97 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | N-[[1-(3-chlorophenyl)cyclopentyl]methyl]-2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxyacetamide |
| SMILES | O=C(COc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)NCC1(c2cccc(Cl)c2)CCCC1 |
| InChI | InChI=1S/C27H26ClN3O6/c28-17-5-3-4-16(12-17)27(10-1-2-11-27)15-29-23(33)14-37-18-6-7-19-20(13-18)26(36)31(25(19)35)21-8-9-22(32)30-24(21)34/h3-7,12-13,21H,1-2,8-11,14-15H2,(H,29,33)(H,30,32,34) |
| InChIKey | HVCSPBZHNKFRTR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|