C22H25N3O7 — CID 166431279
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxy-N-[(1S,2S)-2-methoxycyclohexyl]acetamide (PubChem CID 166431279) has the molecular formula C22H25N3O7 and a molecular weight of 443.46 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxy-N-[(1S,2S)-2-methoxycyclohexyl]acetamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxy-N-[(1S,2S)-2-methoxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 166431279 |
| Molecular Formula | C22H25N3O7 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxy-N-[(1S,2S)-2-methoxycyclohexyl]acetamide |
| SMILES | CO[C@H]1CCCC[C@@H]1NC(=O)COc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H25N3O7/c1-31-17-5-3-2-4-15(17)23-19(27)11-32-12-6-7-13-14(10-12)22(30)25(21(13)29)16-8-9-18(26)24-20(16)28/h6-7,10,15-17H,2-5,8-9,11H2,1H3,(H,23,27)(H,24,26,28)/t15-,16?,17-/m0/s1 |
| InChIKey | YUERQWNQXFQAPX-QRFGZVGRSA-N |
| XLogP | 0.54 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|