C21H28FN3O4 — CID 174235465
3-tert-butyl-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidine-1-carboxylic acid (PubChem CID 174235465) has the molecular formula C21H28FN3O4 and a molecular weight of 405.47 g/mol. Its IUPAC name is 3-tert-butyl-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidine-1-carboxylic acid.
| Compound Name | 3-tert-butyl-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174235465 |
| Molecular Formula | C21H28FN3O4 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 3-tert-butyl-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)CCC1c1ccc(NC2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C21H28FN3O4/c1-21(2,3)14-11-25(20(28)29)9-8-13(14)12-4-5-16(15(22)10-12)23-17-6-7-18(26)24-19(17)27/h4-5,10,13-14,17,23H,6-9,11H2,1-3H3,(H,28,29)(H,24,26,27) |
| InChIKey | QKBYSZQUCBAODR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|