C22H30FN3O4 — CID 156516068
tert-butyl 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidin-1-yl]acetate (PubChem CID 156516068) has the molecular formula C22H30FN3O4 and a molecular weight of 419.50 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 156516068 |
| Molecular Formula | C22H30FN3O4 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl 2-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-fluorophenyl]piperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC(c2ccc(NC3CCC(=O)NC3=O)c(F)c2)CC1 |
| InChI | InChI=1S/C22H30FN3O4/c1-22(2,3)30-20(28)13-26-10-8-14(9-11-26)15-4-5-17(16(23)12-15)24-18-6-7-19(27)25-21(18)29/h4-5,12,14,18,24H,6-11,13H2,1-3H3,(H,25,27,29) |
| InChIKey | LREJJFUSKZBRCT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|