C26H39FN4O3 — CID 170954027
3-[4-[1-[[4-[(2R)-2-aminopropoxy]cyclohexyl]methyl]piperidin-4-yl]-2-fluoroanilino]piperidine-2,6-dione (PubChem CID 170954027) has the molecular formula C26H39FN4O3 and a molecular weight of 474.62 g/mol. Its IUPAC name is 3-[4-[1-[[4-[(2R)-2-aminopropoxy]cyclohexyl]methyl]piperidin-4-yl]-2-fluoroanilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[[4-[(2R)-2-aminopropoxy]cyclohexyl]methyl]piperidin-4-yl]-2-fluoroanilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170954027 |
| Molecular Formula | C26H39FN4O3 |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 3-[4-[1-[[4-[(2R)-2-aminopropoxy]cyclohexyl]methyl]piperidin-4-yl]-2-fluoroanilino]piperidine-2,6-dione |
| SMILES | C[C@@H](N)COC1CCC(CN2CCC(c3ccc(NC4CCC(=O)NC4=O)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H39FN4O3/c1-17(28)16-34-21-5-2-18(3-6-21)15-31-12-10-19(11-13-31)20-4-7-23(22(27)14-20)29-24-8-9-25(32)30-26(24)33/h4,7,14,17-19,21,24,29H,2-3,5-6,8-13,15-16,28H2,1H3,(H,30,32,33)/t17-,18?,21?,24?/m1/s1 |
| InChIKey | YTKXTWLAPQFXPQ-HNWIOCRDSA-N |
| XLogP | 3.14 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|