C24H33N3O3 — CID 165048097
N-cyclopentyl-2-[4-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]piperidin-1-yl]acetamide (PubChem CID 165048097) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-cyclopentyl-2-[4-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]piperidin-1-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[4-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 165048097 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-cyclopentyl-2-[4-[4-[(2,6-dioxopiperidin-3-yl)methyl]phenyl]piperidin-1-yl]acetamide |
| SMILES | O=C1CCC(Cc2ccc(C3CCN(CC(=O)NC4CCCC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H33N3O3/c28-22-10-9-20(24(30)26-22)15-17-5-7-18(8-6-17)19-11-13-27(14-12-19)16-23(29)25-21-3-1-2-4-21/h5-8,19-21H,1-4,9-16H2,(H,25,29)(H,26,28,30) |
| InChIKey | HKTGPSMVRHYNAU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|