C23H22F5N3O5S — CID 176933258
[5-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-4-yl]-3-fluoro-6-methyl-2-pyridinyl] trifluoromethanesulfonate (PubChem CID 176933258) has the molecular formula C23H22F5N3O5S and a molecular weight of 547.50 g/mol. Its IUPAC name is [5-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-4-yl]-3-fluoro-6-methyl-2-pyridinyl] trifluoromethanesulfonate.
| Compound Name | [5-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-4-yl]-3-fluoro-6-methyl-2-pyridinyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176933258 |
| Molecular Formula | C23H22F5N3O5S |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | [5-[1-[4-(2,6-dioxopiperidin-3-yl)-2-fluorophenyl]piperidin-4-yl]-3-fluoro-6-methyl-2-pyridinyl] trifluoromethanesulfonate |
| SMILES | Cc1nc(OS(=O)(=O)C(F)(F)F)c(F)cc1C1CCN(c2ccc(C3CCC(=O)NC3=O)cc2F)CC1 |
| InChI | InChI=1S/C23H22F5N3O5S/c1-12-16(11-18(25)22(29-12)36-37(34,35)23(26,27)28)13-6-8-31(9-7-13)19-4-2-14(10-17(19)24)15-3-5-20(32)30-21(15)33/h2,4,10-11,13,15H,3,5-9H2,1H3,(H,30,32,33) |
| InChIKey | UGUFNGCAMZDSBZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|