C10H10N6O3 — CID 66284011
3-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]piperidine-2,6-dione (PubChem CID 66284011) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]piperidine-2,6-dione.
| Compound Name | 3-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 66284011 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 3-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]piperidine-2,6-dione |
| SMILES | O=C1CCC(Nc2ccc3n[nH]c(=O)n3n2)C(=O)N1 |
| InChI | InChI=1S/C10H10N6O3/c17-8-4-1-5(9(18)12-8)11-6-2-3-7-13-14-10(19)16(7)15-6/h2-3,5H,1,4H2,(H,11,15)(H,14,19)(H,12,17,18) |
| InChIKey | FEQDOMUGUKHBKW-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|