C13H19N5O2 — CID 80941192
3-[[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione (PubChem CID 80941192) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-[[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 80941192 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3-[[2-ethyl-6-(ethylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione |
| SMILES | CCNc1cc(NC2CCC(=O)NC2=O)nc(CC)n1 |
| InChI | InChI=1S/C13H19N5O2/c1-3-9-16-10(14-4-2)7-11(17-9)15-8-5-6-12(19)18-13(8)20/h7-8H,3-6H2,1-2H3,(H,18,19,20)(H2,14,15,16,17) |
| InChIKey | HFNBEQLIABTILF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|