C14H21N5O2 — CID 80938259
3-[[2-ethyl-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione (PubChem CID 80938259) has the molecular formula C14H21N5O2 and a molecular weight of 291.36 g/mol. Its IUPAC name is 3-[[2-ethyl-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[2-ethyl-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 80938259 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 3-[[2-ethyl-6-(propylamino)pyrimidin-4-yl]amino]piperidine-2,6-dione |
| SMILES | CCCNc1cc(NC2CCC(=O)NC2=O)nc(CC)n1 |
| InChI | InChI=1S/C14H21N5O2/c1-3-7-15-11-8-12(18-10(4-2)17-11)16-9-5-6-13(20)19-14(9)21/h8-9H,3-7H2,1-2H3,(H,19,20,21)(H2,15,16,17,18) |
| InChIKey | SBMYSWYPECEFQX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|