C35H36ClFN8O2 — CID 170946287
3-[[6-[1-[[4-[4-[4-(aminomethyl)-3-fluorophenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]-3-pyridinyl]amino]piperidine-2,6-dione;hydrochloride (PubChem CID 170946287) has the molecular formula C35H36ClFN8O2 and a molecular weight of 655.18 g/mol. Its IUPAC name is 3-[[6-[1-[[4-[4-[4-(aminomethyl)-3-fluorophenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]-3-pyridinyl]amino]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[[6-[1-[[4-[4-[4-(aminomethyl)-3-fluorophenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]-3-pyridinyl]amino]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170946287 |
| Molecular Formula | C35H36ClFN8O2 |
| Molecular Weight | 655.18 g/mol |
| Exact Mass | 654.26 |
| IUPAC Name | 3-[[6-[1-[[4-[4-[4-(aminomethyl)-3-fluorophenyl]pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]-3-pyridinyl]amino]piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NCc1ccc(-c2ncnn3cc(-c4ccc(CN5CCC(c6ccc(NC7CCC(=O)NC7=O)cn6)CC5)cc4)cc23)cc1F |
| InChI | InChI=1S/C35H35FN8O2.ClH/c36-29-15-25(5-6-26(29)17-37)34-32-16-27(20-44(32)40-21-39-34)23-3-1-22(2-4-23)19-43-13-11-24(12-14-43)30-8-7-28(18-38-30)41-31-9-10-33(45)42-35(31)46;/h1-8,15-16,18,20-21,24,31,41H,9-14,17,19,37H2,(H,42,45,46);1H |
| InChIKey | MTDRHHOHQCDEPX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 130.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.18 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|