C36H36FN7O2 — CID 166116730
3-[4-[1-[[4-[4-(3-amino-5-fluoro-2-methylphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione (PubChem CID 166116730) has the molecular formula C36H36FN7O2 and a molecular weight of 617.73 g/mol. Its IUPAC name is 3-[4-[1-[[4-[4-(3-amino-5-fluoro-2-methylphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[[4-[4-(3-amino-5-fluoro-2-methylphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166116730 |
| Molecular Formula | C36H36FN7O2 |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | 3-[4-[1-[[4-[4-(3-amino-5-fluoro-2-methylphenyl)pyrrolo[2,1-f][1,2,4]triazin-6-yl]phenyl]methyl]piperidin-4-yl]anilino]piperidine-2,6-dione |
| SMILES | Cc1c(N)cc(F)cc1-c1ncnn2cc(-c3ccc(CN4CCC(c5ccc(NC6CCC(=O)NC6=O)cc5)CC4)cc3)cc12 |
| InChI | InChI=1S/C36H36FN7O2/c1-22-30(17-28(37)18-31(22)38)35-33-16-27(20-44(33)40-21-39-35)25-4-2-23(3-5-25)19-43-14-12-26(13-15-43)24-6-8-29(9-7-24)41-32-10-11-34(45)42-36(32)46/h2-9,16-18,20-21,26,32,41H,10-15,19,38H2,1H3,(H,42,45,46) |
| InChIKey | PCEFRJZRFBFMHL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 117.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|