C12H11FN2O4 — CID 176508898
2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]acetic acid (PubChem CID 176508898) has the molecular formula C12H11FN2O4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]acetic acid.
| Compound Name | 2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]acetic acid |
|---|---|
| PubChem CID | 176508898 |
| Molecular Formula | C12H11FN2O4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-[4-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(N2CCC(=O)NC2=O)cc1F |
| InChI | InChI=1S/C12H11FN2O4/c13-9-6-8(2-1-7(9)5-11(17)18)15-4-3-10(16)14-12(15)19/h1-2,6H,3-5H2,(H,17,18)(H,14,16,19) |
| InChIKey | PBYHSPUTSIDCSI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |