About 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid
2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid (PubChem CID 175752209) has the molecular formula C11H9FN2O4
and a molecular weight of 252.20 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid |
| PubChem CID | 175752209 |
| Molecular Formula | C11H9FN2O4 |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid |
| SMILES | O=C1CCN(c2cc(F)ccc2C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C11H9FN2O4/c12-6-1-2-7(10(16)17)8(5-6)14-4-3-9(15)13-11(14)18/h1-2,5H,3-4H2,(H,16,17)(H,13,15,18) |
| InChIKey | DXFVQTNCNDEVBO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid?
The IUPAC name of 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid (CID 175752209) is 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid.
What is the SMILES notation for 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid?
The canonical SMILES for 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid is O=C1CCN(c2cc(F)ccc2C(=O)O)C(=O)N1.
What is the InChIKey of 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid?
The InChIKey is DXFVQTNCNDEVBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O4/c12-6-1-2-7(10(16)17)8(5-6)14-4-3-9(15)13-11(14)18/h1-2,5H,3-4H2,(H,16,17)(H,13,15,18).
What are the key properties of 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid?
2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid has a molecular weight of 252.20 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1,3-diazinan-1-yl)-4-fluorobenzoic acid is sourced from PubChem (CID 175752209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).