C13H17FN2O2 — CID 167474708
ethane;1-(2-fluoro-5-methylphenyl)-1,3-diazinane-2,4-dione (PubChem CID 167474708) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is ethane;1-(2-fluoro-5-methylphenyl)-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-(2-fluoro-5-methylphenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 167474708 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | ethane;1-(2-fluoro-5-methylphenyl)-1,3-diazinane-2,4-dione |
| SMILES | CC.Cc1ccc(F)c(N2CCC(=O)NC2=O)c1 |
| InChI | InChI=1S/C11H11FN2O2.C2H6/c1-7-2-3-8(12)9(6-7)14-5-4-10(15)13-11(14)16;1-2/h2-3,6H,4-5H2,1H3,(H,13,15,16);1-2H3 |
| InChIKey | WJRCLCPILFIJGL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |