C13H15FN2O4 — CID 156707032
5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzaldehyde;methanol (PubChem CID 156707032) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzaldehyde;methanol.
| Compound Name | 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzaldehyde;methanol |
|---|---|
| PubChem CID | 156707032 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzaldehyde;methanol |
| SMILES | CO.Cc1cc(F)c(C=O)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H11FN2O3.CH4O/c1-7-4-9(13)8(6-16)5-10(7)15-3-2-11(17)14-12(15)18;1-2/h4-6H,2-3H2,1H3,(H,14,17,18);2H,1H3 |
| InChIKey | OPBSISAAVIRXHK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|