C17H19N3O2 — CID 176562093
1-(3-cyclopropyl-1,6-dimethylindol-5-yl)-1,3-diazinane-2,4-dione (PubChem CID 176562093) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1-(3-cyclopropyl-1,6-dimethylindol-5-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(3-cyclopropyl-1,6-dimethylindol-5-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 176562093 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-(3-cyclopropyl-1,6-dimethylindol-5-yl)-1,3-diazinane-2,4-dione |
| SMILES | Cc1cc2c(cc1N1CCC(=O)NC1=O)c(C1CC1)cn2C |
| InChI | InChI=1S/C17H19N3O2/c1-10-7-15-12(13(9-19(15)2)11-3-4-11)8-14(10)20-6-5-16(21)18-17(20)22/h7-9,11H,3-6H2,1-2H3,(H,18,21,22) |
| InChIKey | AWUYKWRWDXEQBD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |