C14H15N3O2 — CID 154953984
1-(1,6-dimethylindol-3-yl)-1,3-diazinane-2,4-dione (PubChem CID 154953984) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-(1,6-dimethylindol-3-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1,6-dimethylindol-3-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 154953984 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-(1,6-dimethylindol-3-yl)-1,3-diazinane-2,4-dione |
| SMILES | Cc1ccc2c(N3CCC(=O)NC3=O)cn(C)c2c1 |
| InChI | InChI=1S/C14H15N3O2/c1-9-3-4-10-11(7-9)16(2)8-12(10)17-6-5-13(18)15-14(17)19/h3-4,7-8H,5-6H2,1-2H3,(H,15,18,19) |
| InChIKey | FMGHFSVOTUJMKP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |