C13H11F2N3O2 — CID 176562532
1-(4,6-difluoro-1-methylindol-5-yl)-1,3-diazinane-2,4-dione (PubChem CID 176562532) has the molecular formula C13H11F2N3O2 and a molecular weight of 279.25 g/mol. Its IUPAC name is 1-(4,6-difluoro-1-methylindol-5-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(4,6-difluoro-1-methylindol-5-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 176562532 |
| Molecular Formula | C13H11F2N3O2 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 1-(4,6-difluoro-1-methylindol-5-yl)-1,3-diazinane-2,4-dione |
| SMILES | Cn1ccc2c(F)c(N3CCC(=O)NC3=O)c(F)cc21 |
| InChI | InChI=1S/C13H11F2N3O2/c1-17-4-2-7-9(17)6-8(14)12(11(7)15)18-5-3-10(19)16-13(18)20/h2,4,6H,3,5H2,1H3,(H,16,19,20) |
| InChIKey | VNTKWBJFOWLHTG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |