C18H22N4O2 — CID 178074052
1-(5-methyl-1-piperidin-4-ylindol-4-yl)-1,3-diazinane-2,4-dione (PubChem CID 178074052) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(5-methyl-1-piperidin-4-ylindol-4-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(5-methyl-1-piperidin-4-ylindol-4-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 178074052 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-(5-methyl-1-piperidin-4-ylindol-4-yl)-1,3-diazinane-2,4-dione |
| SMILES | Cc1ccc2c(ccn2C2CCNCC2)c1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H22N4O2/c1-12-2-3-15-14(6-10-21(15)13-4-8-19-9-5-13)17(12)22-11-7-16(23)20-18(22)24/h2-3,6,10,13,19H,4-5,7-9,11H2,1H3,(H,20,23,24) |
| InChIKey | GCBSFQZIBXQPGR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |