C25H38N4O4 — CID 172604770
2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde;1-methyl-4-(piperidin-4-ylmethyl)piperidine (PubChem CID 172604770) has the molecular formula C25H38N4O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde;1-methyl-4-(piperidin-4-ylmethyl)piperidine.
| Compound Name | 2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde;1-methyl-4-(piperidin-4-ylmethyl)piperidine |
|---|---|
| PubChem CID | 172604770 |
| Molecular Formula | C25H38N4O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 2-[3-(2,4-dioxo-1,3-diazinan-1-yl)-4-methylphenoxy]acetaldehyde;1-methyl-4-(piperidin-4-ylmethyl)piperidine |
| SMILES | CN1CCC(CC2CCNCC2)CC1.Cc1ccc(OCC=O)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O4.C12H24N2/c1-9-2-3-10(19-7-6-16)8-11(9)15-5-4-12(17)14-13(15)18;1-14-8-4-12(5-9-14)10-11-2-6-13-7-3-11/h2-3,6,8H,4-5,7H2,1H3,(H,14,17,18);11-13H,2-10H2,1H3 |
| InChIKey | NWZJMOYPQXZJAK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|