C11H14ClN3O2 — CID 171705611
1-(5-amino-2-methylphenyl)-1,3-diazinane-2,4-dione;hydrochloride (PubChem CID 171705611) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is 1-(5-amino-2-methylphenyl)-1,3-diazinane-2,4-dione;hydrochloride.
| Compound Name | 1-(5-amino-2-methylphenyl)-1,3-diazinane-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 171705611 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 1-(5-amino-2-methylphenyl)-1,3-diazinane-2,4-dione;hydrochloride |
| SMILES | Cc1ccc(N)cc1N1CCC(=O)NC1=O.Cl |
| InChI | InChI=1S/C11H13N3O2.ClH/c1-7-2-3-8(12)6-9(7)14-5-4-10(15)13-11(14)16;/h2-3,6H,4-5,12H2,1H3,(H,13,15,16);1H |
| InChIKey | DCVSVJAWHPHGPH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|