C16H18ClN3O2 — CID 175904788
1-(1-tert-butyl-4-chloroindol-6-yl)-1,3-diazinane-2,4-dione (PubChem CID 175904788) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 1-(1-tert-butyl-4-chloroindol-6-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(1-tert-butyl-4-chloroindol-6-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 175904788 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1-(1-tert-butyl-4-chloroindol-6-yl)-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)n1ccc2c(Cl)cc(N3CCC(=O)NC3=O)cc21 |
| InChI | InChI=1S/C16H18ClN3O2/c1-16(2,3)20-7-4-11-12(17)8-10(9-13(11)20)19-6-5-14(21)18-15(19)22/h4,7-9H,5-6H2,1-3H3,(H,18,21,22) |
| InChIKey | RZRGWJJYZQIESB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |