C23H33FN4O5 — CID 155674613
tert-butyl N-[5-[[5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoyl]-methylamino]pentyl]carbamate (PubChem CID 155674613) has the molecular formula C23H33FN4O5 and a molecular weight of 464.54 g/mol. Its IUPAC name is tert-butyl N-[5-[[5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoyl]-methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoyl]-methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 155674613 |
| Molecular Formula | C23H33FN4O5 |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | tert-butyl N-[5-[[5-(2,4-dioxo-1,3-diazinan-1-yl)-2-fluoro-4-methylbenzoyl]-methylamino]pentyl]carbamate |
| SMILES | Cc1cc(F)c(C(=O)N(C)CCCCCNC(=O)OC(C)(C)C)cc1N1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H33FN4O5/c1-15-13-17(24)16(14-18(15)28-12-9-19(29)26-21(28)31)20(30)27(5)11-8-6-7-10-25-22(32)33-23(2,3)4/h13-14H,6-12H2,1-5H3,(H,25,32)(H,26,29,31) |
| InChIKey | BSMAQDVGMQTBFO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|