C25H39FN4O — CID 176967644
butane;3-[3-fluoro-4-(4-pent-4-enylpiperazin-1-yl)anilino]-6-methylidenepiperidin-2-one (PubChem CID 176967644) has the molecular formula C25H39FN4O and a molecular weight of 430.61 g/mol. Its IUPAC name is butane;3-[3-fluoro-4-(4-pent-4-enylpiperazin-1-yl)anilino]-6-methylidenepiperidin-2-one.
| Compound Name | butane;3-[3-fluoro-4-(4-pent-4-enylpiperazin-1-yl)anilino]-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 176967644 |
| Molecular Formula | C25H39FN4O |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | butane;3-[3-fluoro-4-(4-pent-4-enylpiperazin-1-yl)anilino]-6-methylidenepiperidin-2-one |
| SMILES | C=CCCCN1CCN(c2ccc(NC3CCC(=C)NC3=O)cc2F)CC1.CCCC |
| InChI | InChI=1S/C21H29FN4O.C4H10/c1-3-4-5-10-25-11-13-26(14-12-25)20-9-7-17(15-18(20)22)24-19-8-6-16(2)23-21(19)27;1-3-4-2/h3,7,9,15,19,24H,1-2,4-6,8,10-14H2,(H,23,27);3-4H2,1-2H3 |
| InChIKey | JQHNWNSHEIYBMZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|