C15H18N4O3 — CID 167282536
1-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]pyrrolidine-3-carbaldehyde (PubChem CID 167282536) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]pyrrolidine-3-carbaldehyde.
| Compound Name | 1-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]pyrrolidine-3-carbaldehyde |
|---|---|
| PubChem CID | 167282536 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 1-[5-[(2,6-dioxopiperidin-3-yl)amino]-2-pyridinyl]pyrrolidine-3-carbaldehyde |
| SMILES | O=CC1CCN(c2ccc(NC3CCC(=O)NC3=O)cn2)C1 |
| InChI | InChI=1S/C15H18N4O3/c20-9-10-5-6-19(8-10)13-3-1-11(7-16-13)17-12-2-4-14(21)18-15(12)22/h1,3,7,9-10,12,17H,2,4-6,8H2,(H,18,21,22) |
| InChIKey | JEOSLLUHGFTXLP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|