C18H23N3O3 — CID 167282347
1-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-methylphenyl]piperidine-4-carbaldehyde (PubChem CID 167282347) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-methylphenyl]piperidine-4-carbaldehyde.
| Compound Name | 1-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-methylphenyl]piperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 167282347 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[4-[(2,6-dioxopiperidin-3-yl)amino]-3-methylphenyl]piperidine-4-carbaldehyde |
| SMILES | Cc1cc(N2CCC(C=O)CC2)ccc1NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H23N3O3/c1-12-10-14(21-8-6-13(11-22)7-9-21)2-3-15(12)19-16-4-5-17(23)20-18(16)24/h2-3,10-11,13,16,19H,4-9H2,1H3,(H,20,23,24) |
| InChIKey | MTKFOXVGOGLIJR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|