C17H20ClN3O3 — CID 71964870
3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[[(2R)-2-hydroxypropyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 71964870) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[[(2R)-2-hydroxypropyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[[(2R)-2-hydroxypropyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 71964870 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 3-[4-(3-chlorophenyl)piperazin-1-yl]-4-[[(2R)-2-hydroxypropyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | C[C@@H](O)CNc1c(N2CCN(c3cccc(Cl)c3)CC2)c(=O)c1=O |
| InChI | InChI=1S/C17H20ClN3O3/c1-11(22)10-19-14-15(17(24)16(14)23)21-7-5-20(6-8-21)13-4-2-3-12(18)9-13/h2-4,9,11,19,22H,5-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | KJRHPKAPBLSLEF-LLVKDONJSA-N |
| XLogP | 1.06 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|