C23H31N5O4 — CID 91336843
ethyl 1-[5-nitro-6-(N-pentan-2-ylanilino)pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 91336843) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is ethyl 1-[5-nitro-6-(N-pentan-2-ylanilino)pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-nitro-6-(N-pentan-2-ylanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 91336843 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | ethyl 1-[5-nitro-6-(N-pentan-2-ylanilino)pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCCC(C)N(c1ccccc1)c1ncnc(N2CCC(C(=O)OCC)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H31N5O4/c1-4-9-17(3)27(19-10-7-6-8-11-19)22-20(28(30)31)21(24-16-25-22)26-14-12-18(13-15-26)23(29)32-5-2/h6-8,10-11,16-18H,4-5,9,12-15H2,1-3H3 |
| InChIKey | KVUIPZJKRNQJLS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 101.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|