C40H46N8O11S — CID 159731862
ethyl 1-[6-(4-acetylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate;ethyl 1-[6-(4-ethylsulfonylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 159731862) has the molecular formula C40H46N8O11S and a molecular weight of 846.92 g/mol. Its IUPAC name is ethyl 1-[6-(4-acetylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate;ethyl 1-[6-(4-ethylsulfonylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-(4-acetylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate;ethyl 1-[6-(4-ethylsulfonylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 159731862 |
| Molecular Formula | C40H46N8O11S |
| Molecular Weight | 846.92 g/mol |
| Exact Mass | 846.30 |
| IUPAC Name | ethyl 1-[6-(4-acetylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate;ethyl 1-[6-(4-ethylsulfonylphenyl)-5-nitropyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(-c3ccc(C(C)=O)cc3)c2[N+](=O)[O-])CC1.CCOC(=O)C1CCN(c2ncnc(-c3ccc(S(=O)(=O)CC)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H24N4O6S.C20H22N4O5/c1-3-30-20(25)15-9-11-23(12-10-15)19-18(24(26)27)17(21-13-22-19)14-5-7-16(8-6-14)31(28,29)4-2;1-3-29-20(26)16-8-10-23(11-9-16)19-18(24(27)28)17(21-12-22-19)15-6-4-14(5-7-15)13(2)25/h5-8,13,15H,3-4,9-12H2,1-2H3;4-7,12,16H,3,8-11H2,1-2H3 |
| InChIKey | NBIGVWNJCCDZJD-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 248.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.92 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|