C16H20ClN5O2 — CID 23491848
4-N-butyl-6-N-[(2-chlorophenyl)methyl]-4-N-methyl-5-nitropyrimidine-4,6-diamine (PubChem CID 23491848) has the molecular formula C16H20ClN5O2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 4-N-butyl-6-N-[(2-chlorophenyl)methyl]-4-N-methyl-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-butyl-6-N-[(2-chlorophenyl)methyl]-4-N-methyl-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23491848 |
| Molecular Formula | C16H20ClN5O2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 4-N-butyl-6-N-[(2-chlorophenyl)methyl]-4-N-methyl-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCN(C)c1ncnc(NCc2ccccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20ClN5O2/c1-3-4-9-21(2)16-14(22(23)24)15(19-11-20-16)18-10-12-7-5-6-8-13(12)17/h5-8,11H,3-4,9-10H2,1-2H3,(H,18,19,20) |
| InChIKey | KCUMHRIJBFXRHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|