C16H21N5O2 — CID 23491754
4-N-butyl-4-N-methyl-6-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23491754) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-N-butyl-4-N-methyl-6-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-butyl-4-N-methyl-6-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23491754 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-N-butyl-4-N-methyl-6-N-(3-methylphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCCCN(C)c1ncnc(Nc2cccc(C)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N5O2/c1-4-5-9-20(3)16-14(21(22)23)15(17-11-18-16)19-13-8-6-7-12(2)10-13/h6-8,10-11H,4-5,9H2,1-3H3,(H,17,18,19) |
| InChIKey | FIQXHKFGOSUEOR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|