C14H18N6O4 — CID 23491801
N'-[6-[butyl(methyl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 23491801) has the molecular formula C14H18N6O4 and a molecular weight of 334.34 g/mol. Its IUPAC name is N'-[6-[butyl(methyl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-[butyl(methyl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 23491801 |
| Molecular Formula | C14H18N6O4 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N'-[6-[butyl(methyl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | CCCCN(C)c1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N6O4/c1-3-4-7-19(2)13-11(20(22)23)12(15-9-16-13)17-18-14(21)10-6-5-8-24-10/h5-6,8-9H,3-4,7H2,1-2H3,(H,18,21)(H,15,16,17) |
| InChIKey | WUJDLMYDXDTUKU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|