C19H25N7O4 — CID 22526089
2-methoxy-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 22526089) has the molecular formula C19H25N7O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-methoxy-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2-methoxy-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22526089 |
| Molecular Formula | C19H25N7O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-methoxy-N'-[5-nitro-6-(2-piperidin-1-ylethylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | COc1ccccc1C(=O)NNc1ncnc(NCCN2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N7O4/c1-30-15-8-4-3-7-14(15)19(27)24-23-18-16(26(28)29)17(21-13-22-18)20-9-12-25-10-5-2-6-11-25/h3-4,7-8,13H,2,5-6,9-12H2,1H3,(H,24,27)(H2,20,21,22,23) |
| InChIKey | JMRTWEDKXFHQPZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|