C12H11Cl2N5O3 — CID 135575699
N'-(5-amino-6-oxo-1H-pyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide (PubChem CID 135575699) has the molecular formula C12H11Cl2N5O3 and a molecular weight of 344.16 g/mol. Its IUPAC name is N'-(5-amino-6-oxo-1H-pyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide.
| Compound Name | N'-(5-amino-6-oxo-1H-pyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 135575699 |
| Molecular Formula | C12H11Cl2N5O3 |
| Molecular Weight | 344.16 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | N'-(5-amino-6-oxo-1H-pyrimidin-4-yl)-2-(2,4-dichlorophenoxy)acetohydrazide |
| SMILES | Nc1c(NNC(=O)COc2ccc(Cl)cc2Cl)nc[nH]c1=O |
| InChI | InChI=1S/C12H11Cl2N5O3/c13-6-1-2-8(7(14)3-6)22-4-9(20)18-19-11-10(15)12(21)17-5-16-11/h1-3,5H,4,15H2,(H,18,20)(H2,16,17,19,21) |
| InChIKey | JKQAWCYZQLDZET-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|